C32H50N2O3 — CID 159508559
benzyl N-[3-[3-(3,4-dimethylphenyl)propanoylamino]propyl]-N-methylcarbamate;nonane (PubChem CID 159508559) has the molecular formula C32H50N2O3 and a molecular weight of 510.76 g/mol. Its IUPAC name is benzyl N-[3-[3-(3,4-dimethylphenyl)propanoylamino]propyl]-N-methylcarbamate;nonane.
| Compound Name | benzyl N-[3-[3-(3,4-dimethylphenyl)propanoylamino]propyl]-N-methylcarbamate;nonane |
|---|---|
| PubChem CID | 159508559 |
| Molecular Formula | C32H50N2O3 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | benzyl N-[3-[3-(3,4-dimethylphenyl)propanoylamino]propyl]-N-methylcarbamate;nonane |
| SMILES | CCCCCCCCC.Cc1ccc(CCC(=O)NCCCN(C)C(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C23H30N2O3.C9H20/c1-18-10-11-20(16-19(18)2)12-13-22(26)24-14-7-15-25(3)23(27)28-17-21-8-5-4-6-9-21;1-3-5-7-9-8-6-4-2/h4-6,8-11,16H,7,12-15,17H2,1-3H3,(H,24,26);3-9H2,1-2H3 |
| InChIKey | MAHQJHKMTWBYQD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|