C25H36N2O2 — CID 121399532
N-(3-aminopropyl)-3-(3-methyl-4-phenylmethoxyphenyl)-N-pentylpropanamide (PubChem CID 121399532) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(3-methyl-4-phenylmethoxyphenyl)-N-pentylpropanamide.
| Compound Name | N-(3-aminopropyl)-3-(3-methyl-4-phenylmethoxyphenyl)-N-pentylpropanamide |
|---|---|
| PubChem CID | 121399532 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | N-(3-aminopropyl)-3-(3-methyl-4-phenylmethoxyphenyl)-N-pentylpropanamide |
| SMILES | CCCCCN(CCCN)C(=O)CCc1ccc(OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H36N2O2/c1-3-4-8-17-27(18-9-16-26)25(28)15-13-22-12-14-24(21(2)19-22)29-20-23-10-6-5-7-11-23/h5-7,10-12,14,19H,3-4,8-9,13,15-18,20,26H2,1-2H3 |
| InChIKey | JDXLAJLQAWHCJV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|