C18H30N2O2 — CID 82071433
3-(3-amino-4-methoxyphenyl)-N,N-dibutylpropanamide (PubChem CID 82071433) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-(3-amino-4-methoxyphenyl)-N,N-dibutylpropanamide.
| Compound Name | 3-(3-amino-4-methoxyphenyl)-N,N-dibutylpropanamide |
|---|---|
| PubChem CID | 82071433 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 3-(3-amino-4-methoxyphenyl)-N,N-dibutylpropanamide |
| SMILES | CCCCN(CCCC)C(=O)CCc1ccc(OC)c(N)c1 |
| InChI | InChI=1S/C18H30N2O2/c1-4-6-12-20(13-7-5-2)18(21)11-9-15-8-10-17(22-3)16(19)14-15/h8,10,14H,4-7,9,11-13,19H2,1-3H3 |
| InChIKey | HLPHEKBVFLXJTH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|