C22H19BrFN3O5S — CID 137162383
2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]acetamide (PubChem CID 137162383) has the molecular formula C22H19BrFN3O5S and a molecular weight of 536.38 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137162383 |
| Molecular Formula | C22H19BrFN3O5S |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C22H19BrFN3O5S/c1-32-20-12-15(11-19(23)22(20)29)13-25-26-21(28)14-27(17-9-7-16(24)8-10-17)33(30,31)18-5-3-2-4-6-18/h2-13,29H,14H2,1H3,(H,26,28)/b25-13- |
| InChIKey | NBCMBWRFCSGONV-MXAYSNPKSA-N |
| XLogP | 3.65 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|