C23H21BrFN3O5S — CID 3400381
N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 3400381) has the molecular formula C23H21BrFN3O5S and a molecular weight of 550.41 g/mol. Its IUPAC name is N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3400381 |
| Molecular Formula | C23H21BrFN3O5S |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1cc(C=NNC(=O)CN(c2ccccc2F)S(=O)(=O)c2ccc(C)cc2)cc(Br)c1O |
| InChI | InChI=1S/C23H21BrFN3O5S/c1-15-7-9-17(10-8-15)34(31,32)28(20-6-4-3-5-19(20)25)14-22(29)27-26-13-16-11-18(24)23(30)21(12-16)33-2/h3-13,30H,14H2,1-2H3,(H,27,29) |
| InChIKey | DFQGVHMWNZLEGO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|