C25H25BrClN3O8S — CID 165366783
N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetamide (PubChem CID 165366783) has the molecular formula C25H25BrClN3O8S and a molecular weight of 642.91 g/mol. Its IUPAC name is N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetamide.
| Compound Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 165366783 |
| Molecular Formula | C25H25BrClN3O8S |
| Molecular Weight | 642.91 g/mol |
| Exact Mass | 641.02 |
| IUPAC Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2cc(Br)c(O)c(OC)c2)c2cc(Cl)ccc2OC)cc1OC |
| InChI | InChI=1S/C25H25BrClN3O8S/c1-35-20-7-5-16(27)11-19(20)30(39(33,34)17-6-8-21(36-2)22(12-17)37-3)14-24(31)29-28-13-15-9-18(26)25(32)23(10-15)38-4/h5-13,32H,14H2,1-4H3,(H,29,31) |
| InChIKey | WHHOZERAQJBQLH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|