C26H28ClN3O8S — CID 137044741
2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 137044741) has the molecular formula C26H28ClN3O8S and a molecular weight of 578.04 g/mol. Its IUPAC name is 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137044741 |
| Molecular Formula | C26H28ClN3O8S |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN(c2cc(Cl)ccc2OC)S(=O)(=O)c2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C26H28ClN3O8S/c1-5-38-24-12-17(6-9-21(24)31)15-28-29-26(32)16-30(20-13-18(27)7-10-22(20)35-2)39(33,34)19-8-11-23(36-3)25(14-19)37-4/h6-15,31H,5,16H2,1-4H3,(H,29,32)/b28-15- |
| InChIKey | FZUMNMQTDCUQCY-MBTHVWNTSA-N |
| XLogP | 3.82 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|