C16H16N2O5 — CID 136986984
benzyl N-[(E)-(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]carbamate (PubChem CID 136986984) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is benzyl N-[(E)-(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | benzyl N-[(E)-(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 136986984 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | benzyl N-[(E)-(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]carbamate |
| SMILES | COc1cc(/C=N/NC(=O)OCc2ccccc2)cc(O)c1O |
| InChI | InChI=1S/C16H16N2O5/c1-22-14-8-12(7-13(19)15(14)20)9-17-18-16(21)23-10-11-5-3-2-4-6-11/h2-9,19-20H,10H2,1H3,(H,18,21)/b17-9+ |
| InChIKey | CTHKEJCLXASFKU-RQZCQDPDSA-N |
| XLogP | 2.37 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|