C17H21N5O5 — CID 136787619
4-ethyl-2-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one (PubChem CID 136787619) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is 4-ethyl-2-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136787619 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-ethyl-2-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(N/N=C\c2cc(OC)c(OC(C)C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H21N5O5/c1-5-12-8-15(23)20-17(19-12)21-18-9-11-6-13(22(24)25)16(27-10(2)3)14(7-11)26-4/h6-10H,5H2,1-4H3,(H2,19,20,21,23)/b18-9- |
| InChIKey | IQXAEMQXXBMDLZ-NVMNQCDNSA-N |
| XLogP | 2.48 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|