C15H16ClN5O5 — CID 110509782
5-chloro-4-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 110509782) has the molecular formula C15H16ClN5O5 and a molecular weight of 381.78 g/mol. Its IUPAC name is 5-chloro-4-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 110509782 |
| Molecular Formula | C15H16ClN5O5 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 5-chloro-4-[(2Z)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | COc1cc(/C=N\Nc2cn[nH]c(=O)c2Cl)cc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C15H16ClN5O5/c1-8(2)26-14-11(21(23)24)4-9(5-12(14)25-3)6-17-19-10-7-18-20-15(22)13(10)16/h4-8H,1-3H3,(H2,19,20,22)/b17-6- |
| InChIKey | MLVGNKWYQWAZRX-FMQZQXMHSA-N |
| XLogP | 2.57 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|