C17H20N6O7 — CID 110511471
3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]propanamide (PubChem CID 110511471) has the molecular formula C17H20N6O7 and a molecular weight of 420.38 g/mol. Its IUPAC name is 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 110511471 |
| Molecular Formula | C17H20N6O7 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(/C=N/NC(=O)CCc2n[nH]c(=O)[nH]c2=O)cc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C17H20N6O7/c1-9(2)30-15-12(23(27)28)6-10(7-13(15)29-3)8-18-21-14(24)5-4-11-16(25)19-17(26)22-20-11/h6-9H,4-5H2,1-3H3,(H,21,24)(H2,19,22,25,26)/b18-8+ |
| InChIKey | KBLPPVVSVVYCGI-QGMBQPNBSA-N |
| XLogP | 0.25 |
| TPSA | 181.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|