C16H18N6O6 — CID 110511498
3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-nitro-4-propoxyphenyl)methylideneamino]propanamide (PubChem CID 110511498) has the molecular formula C16H18N6O6 and a molecular weight of 390.36 g/mol. Its IUPAC name is 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-nitro-4-propoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-nitro-4-propoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 110511498 |
| Molecular Formula | C16H18N6O6 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(E)-(3-nitro-4-propoxyphenyl)methylideneamino]propanamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)CCc2n[nH]c(=O)[nH]c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N6O6/c1-2-7-28-13-5-3-10(8-12(13)22(26)27)9-17-20-14(23)6-4-11-15(24)18-16(25)21-19-11/h3,5,8-9H,2,4,6-7H2,1H3,(H,20,23)(H2,18,21,24,25)/b17-9+ |
| InChIKey | YZBDORAJYCYUED-RQZCQDPDSA-N |
| XLogP | 0.24 |
| TPSA | 172.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|