C19H18N6O4 — CID 136789092
3-[(2E)-2-[(3-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 136789092) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 3-[(2E)-2-[(3-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(3-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789092 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-[(2E)-2-[(3-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | CCCOc1ccc(/C=N/Nc2nnc(-c3ccccc3)c(=O)[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N6O4/c1-2-10-29-16-9-8-13(11-15(16)25(27)28)12-20-23-19-21-18(26)17(22-24-19)14-6-4-3-5-7-14/h3-9,11-12H,2,10H2,1H3,(H2,21,23,24,26)/b20-12+ |
| InChIKey | WHUOKGFGWPQUIL-UDWIEESQSA-N |
| XLogP | 2.97 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|