C17H14N6O5 — CID 136789034
3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 136789034) has the molecular formula C17H14N6O5 and a molecular weight of 382.34 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789034 |
| Molecular Formula | C17H14N6O5 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/Nc2nnc(-c3ccccc3)c(=O)[nH]2)c1O |
| InChI | InChI=1S/C17H14N6O5/c1-28-13-8-12(23(26)27)7-11(15(13)24)9-18-21-17-19-16(25)14(20-22-17)10-5-3-2-4-6-10/h2-9,24H,1H3,(H2,19,21,22,25)/b18-9+ |
| InChIKey | NAKCXKUKKCMTCY-GIJQJNRQSA-N |
| XLogP | 1.90 |
| TPSA | 155.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|