C19H19N5O4 — CID 136789096
6-phenyl-3-[(2E)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 136789096) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 6-phenyl-3-[(2E)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-phenyl-3-[(2E)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789096 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 6-phenyl-3-[(2E)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/Nc1nnc(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H19N5O4/c1-26-14-10-16(28-3)15(27-2)9-13(14)11-20-23-19-21-18(25)17(22-24-19)12-7-5-4-6-8-12/h4-11H,1-3H3,(H2,21,23,24,25)/b20-11+ |
| InChIKey | VVZOJLRDOKJFAO-RGVLZGJSSA-N |
| XLogP | 2.30 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|