C16H11Cl2N5O — CID 135773796
3-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 135773796) has the molecular formula C16H11Cl2N5O and a molecular weight of 360.20 g/mol. Its IUPAC name is 3-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135773796 |
| Molecular Formula | C16H11Cl2N5O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 3-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(N/N=C/c2ccc(Cl)cc2Cl)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H11Cl2N5O/c17-12-7-6-11(13(18)8-12)9-19-22-16-20-15(24)14(21-23-16)10-4-2-1-3-5-10/h1-9H,(H2,20,22,23,24)/b19-9+ |
| InChIKey | QQPOPYVTSLVVNO-DJKKODMXSA-N |
| XLogP | 3.58 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|