C10H7Cl2N5O — CID 135450335
3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135450335) has the molecular formula C10H7Cl2N5O and a molecular weight of 284.11 g/mol. Its IUPAC name is 3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135450335 |
| Molecular Formula | C10H7Cl2N5O |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(NN=Cc2ccc(Cl)cc2Cl)[nH]1 |
| InChI | InChI=1S/C10H7Cl2N5O/c11-7-2-1-6(8(12)3-7)4-13-16-10-15-9(18)5-14-17-10/h1-5H,(H2,15,16,17,18) |
| InChIKey | HAMKKHZNNAIGEO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|