C11H9N5O3 — CID 135454365
3-[(2E)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135454365) has the molecular formula C11H9N5O3 and a molecular weight of 259.22 g/mol. Its IUPAC name is 3-[(2E)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135454365 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-[(2E)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(N/N=C/c2ccc3c(c2)OCO3)[nH]1 |
| InChI | InChI=1S/C11H9N5O3/c17-10-5-13-16-11(14-10)15-12-4-7-1-2-8-9(3-7)19-6-18-8/h1-5H,6H2,(H2,14,15,16,17)/b12-4+ |
| InChIKey | QBFITVUERQGGPD-UUILKARUSA-N |
| XLogP | 0.34 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|