C18H14ClN5O4 — CID 136733729
[2-methoxy-4-[(E)-[(5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 136733729) has the molecular formula C18H14ClN5O4 and a molecular weight of 399.79 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[(5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-[(5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 136733729 |
| Molecular Formula | C18H14ClN5O4 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [2-methoxy-4-[(E)-[(5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=N/Nc2nncc(=O)[nH]2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN5O4/c1-27-15-8-11(9-20-23-18-22-16(25)10-21-24-18)2-7-14(15)28-17(26)12-3-5-13(19)6-4-12/h2-10H,1H3,(H2,22,23,24,25)/b20-9+ |
| InChIKey | RUCMMEKKMLKMIF-AWQFTUOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|