C19H16ClN5O4 — CID 135784996
[2-methoxy-4-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 135784996) has the molecular formula C19H16ClN5O4 and a molecular weight of 413.82 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 135784996 |
| Molecular Formula | C19H16ClN5O4 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [2-methoxy-4-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | COc1cc(/C=N\Nc2nnc(C)c(=O)[nH]2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H16ClN5O4/c1-11-17(26)22-19(25-23-11)24-21-10-12-7-8-15(16(9-12)28-2)29-18(27)13-5-3-4-6-14(13)20/h3-10H,1-2H3,(H2,22,24,25,26)/b21-10- |
| InChIKey | PGWDGQGQALHXOA-FBHDLOMBSA-N |
| XLogP | 2.80 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|