C19H16FN5O4 — CID 135982699
[2-methoxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate (PubChem CID 135982699) has the molecular formula C19H16FN5O4 and a molecular weight of 397.37 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 135982699 |
| Molecular Formula | C19H16FN5O4 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [2-methoxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
| SMILES | COc1cc(/C=N/Nc2nnc(C)c(=O)[nH]2)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FN5O4/c1-11-17(26)22-19(25-23-11)24-21-10-12-3-8-15(16(9-12)28-2)29-18(27)13-4-6-14(20)7-5-13/h3-10H,1-2H3,(H2,22,24,25,26)/b21-10+ |
| InChIKey | RVRAQXLGOLKFIJ-UFFVCSGVSA-N |
| XLogP | 2.29 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|