C19H18ClN5O4 — CID 136789255
3-[(2E)-2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one (PubChem CID 136789255) has the molecular formula C19H18ClN5O4 and a molecular weight of 415.84 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789255 |
| Molecular Formula | C19H18ClN5O4 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-[(2E)-2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(-c2nnc(N/N=C/c3ccc(OC)c(OC)c3Cl)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H18ClN5O4/c1-27-13-7-4-11(5-8-13)16-18(26)22-19(25-23-16)24-21-10-12-6-9-14(28-2)17(29-3)15(12)20/h4-10H,1-3H3,(H2,22,24,25,26)/b21-10+ |
| InChIKey | VRQXWMKLIFGZFG-UFFVCSGVSA-N |
| XLogP | 2.96 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|