C18H16BrN5O3 — CID 136789165
3-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one (PubChem CID 136789165) has the molecular formula C18H16BrN5O3 and a molecular weight of 430.26 g/mol. Its IUPAC name is 3-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789165 |
| Molecular Formula | C18H16BrN5O3 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 3-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(-c2nnc(N/N=C/c3cc(Br)ccc3OC)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H16BrN5O3/c1-26-14-6-3-11(4-7-14)16-17(25)21-18(24-22-16)23-20-10-12-9-13(19)5-8-15(12)27-2/h3-10H,1-2H3,(H2,21,23,24,25)/b20-10+ |
| InChIKey | JDLSJRSTMQXIBF-KEBDBYFISA-N |
| XLogP | 3.06 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|