C18H16N6O6 — CID 136789184
3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one (PubChem CID 136789184) has the molecular formula C18H16N6O6 and a molecular weight of 412.36 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789184 |
| Molecular Formula | C18H16N6O6 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-[(2E)-2-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(-c2nnc(N/N=C/c3cc([N+](=O)[O-])cc(OC)c3O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H16N6O6/c1-29-13-5-3-10(4-6-13)15-17(26)20-18(23-21-15)22-19-9-11-7-12(24(27)28)8-14(30-2)16(11)25/h3-9,25H,1-2H3,(H2,20,22,23,26)/b19-9+ |
| InChIKey | GPSGEYVGCQPMGF-DJKKODMXSA-N |
| XLogP | 1.91 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|