C13H12ClN7O5 — CID 110511668
N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide (PubChem CID 110511668) has the molecular formula C13H12ClN7O5 and a molecular weight of 381.74 g/mol. Its IUPAC name is N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide.
| Compound Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
|---|---|
| PubChem CID | 110511668 |
| Molecular Formula | C13H12ClN7O5 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
| SMILES | O=C(CCNc1n[nH]c(=O)[nH]c1=O)N/N=C/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12ClN7O5/c14-8-2-1-7(5-9(8)21(25)26)6-16-18-10(22)3-4-15-11-12(23)17-13(24)20-19-11/h1-2,5-6H,3-4H2,(H,15,19)(H,18,22)(H2,17,20,23,24)/b16-6+ |
| InChIKey | XUVJXFWEUIPJRC-OMCISZLKSA-N |
| XLogP | -0.03 |
| TPSA | 175.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|