C13H14N6O4 — CID 136787367
3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 136787367) has the molecular formula C13H14N6O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 136787367 |
| Molecular Formula | C13H14N6O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCNc1n[nH]c(=O)[nH]c1=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C13H14N6O4/c20-9-4-2-1-3-8(9)7-15-17-10(21)5-6-14-11-12(22)16-13(23)19-18-11/h1-4,7,20H,5-6H2,(H,14,18)(H,17,21)(H2,16,19,22,23)/b15-7+ |
| InChIKey | BCVMGKBHFJIXKJ-VIZOYTHASA-N |
| XLogP | -0.88 |
| TPSA | 152.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|