C16H20N6O6 — CID 110511620
3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 110511620) has the molecular formula C16H20N6O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 110511620 |
| Molecular Formula | C16H20N6O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/NC(=O)CCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20N6O6/c1-26-10-7-12(28-3)11(27-2)6-9(10)8-18-20-13(23)4-5-17-14-15(24)19-16(25)22-21-14/h6-8H,4-5H2,1-3H3,(H,17,21)(H,20,23)(H2,19,22,24,25)/b18-8+ |
| InChIKey | QYOKHWSLCSBZDE-QGMBQPNBSA-N |
| XLogP | -0.56 |
| TPSA | 159.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|