C16H19BrN6O5 — CID 110511628
N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide (PubChem CID 110511628) has the molecular formula C16H19BrN6O5 and a molecular weight of 455.27 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide.
| Compound Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
|---|---|
| PubChem CID | 110511628 |
| Molecular Formula | C16H19BrN6O5 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
| SMILES | CCOc1c(Br)cc(/C=N/NC(=O)CCNc2n[nH]c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C16H19BrN6O5/c1-3-28-13-10(17)6-9(7-11(13)27-2)8-19-21-12(24)4-5-18-14-15(25)20-16(26)23-22-14/h6-8H,3-5H2,1-2H3,(H,18,22)(H,21,24)(H2,20,23,25,26)/b19-8+ |
| InChIKey | HXHSWFYVQBWFHS-UFWORHAWSA-N |
| XLogP | 0.58 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|