C19H20N6O4 — CID 110511591
3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]propanamide (PubChem CID 110511591) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]propanamide.
| Compound Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 110511591 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]propanamide |
| SMILES | CCOc1ccc2ccccc2c1/C=N/NC(=O)CCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H20N6O4/c1-2-29-15-8-7-12-5-3-4-6-13(12)14(15)11-21-23-16(26)9-10-20-17-18(27)22-19(28)25-24-17/h3-8,11H,2,9-10H2,1H3,(H,20,24)(H,23,26)(H2,22,25,27,28)/b21-11+ |
| InChIKey | FZVPWNZZLYYDNH-SRZZPIQSSA-N |
| XLogP | 0.96 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|