C19H25ClN6O5 — CID 110511601
N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide (PubChem CID 110511601) has the molecular formula C19H25ClN6O5 and a molecular weight of 452.90 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide.
| Compound Name | N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
|---|---|
| PubChem CID | 110511601 |
| Molecular Formula | C19H25ClN6O5 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CCNc2n[nH]c(=O)[nH]c2=O)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C19H25ClN6O5/c1-4-30-14-8-12(7-13(20)16(14)31-10-11(2)3)9-22-24-15(27)5-6-21-17-18(28)23-19(29)26-25-17/h7-9,11H,4-6,10H2,1-3H3,(H,21,25)(H,24,27)(H2,23,26,28,29)/b22-9+ |
| InChIKey | NGMUQMLZGBHOIA-LSFURLLWSA-N |
| XLogP | 1.50 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|