C17H21ClN6O5 — CID 110511765
N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide (PubChem CID 110511765) has the molecular formula C17H21ClN6O5 and a molecular weight of 424.85 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 110511765 |
| Molecular Formula | C17H21ClN6O5 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CNc2n[nH]c(=O)[nH]c2=O)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C17H21ClN6O5/c1-4-28-12-6-10(5-11(18)14(12)29-9(2)3)7-20-22-13(25)8-19-15-16(26)21-17(27)24-23-15/h5-7,9H,4,8H2,1-3H3,(H,19,23)(H,22,25)(H2,21,24,26,27)/b20-7+ |
| InChIKey | BFCSGQKIMSQPKH-IFRROFPPSA-N |
| XLogP | 0.86 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|