C13H14N6O3 — CID 110337447
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-methylphenyl)methylideneamino]acetamide (PubChem CID 110337447) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110337447 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N/NC(=O)CNc2n[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H14N6O3/c1-8-2-4-9(5-3-8)6-15-17-10(20)7-14-11-12(21)16-13(22)19-18-11/h2-6H,7H2,1H3,(H,14,18)(H,17,20)(H2,16,19,21,22)/b15-6+ |
| InChIKey | DUVMPRKYSOJREM-GIDUJCDVSA-N |
| XLogP | -0.67 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|