C17H14N6O6 — CID 110341117
[4-[(E)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 110341117) has the molecular formula C17H14N6O6 and a molecular weight of 398.34 g/mol. Its IUPAC name is [4-[(E)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 110341117 |
| Molecular Formula | C17H14N6O6 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [4-[(E)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(CNc1n[nH]c(=O)[nH]c1=O)N/N=C/c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H14N6O6/c24-13(9-18-14-15(25)20-17(27)23-22-14)21-19-8-10-3-5-11(6-4-10)29-16(26)12-2-1-7-28-12/h1-8H,9H2,(H,18,22)(H,21,24)(H2,20,23,25,27)/b19-8+ |
| InChIKey | PXASURCWRITXNS-UFWORHAWSA-N |
| XLogP | -0.17 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|