C23H18N4O5 — CID 110341147
[4-[(E)-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylhydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 110341147) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is [4-[(E)-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylhydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylhydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 110341147 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [4-[(E)-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylhydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(CCc1nc2ccccc2[nH]c1=O)N/N=C/c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H18N4O5/c28-21(12-11-19-22(29)26-18-5-2-1-4-17(18)25-19)27-24-14-15-7-9-16(10-8-15)32-23(30)20-6-3-13-31-20/h1-10,13-14H,11-12H2,(H,26,29)(H,27,28)/b24-14+ |
| InChIKey | KALKJROQQULJSN-ZVHZXABRSA-N |
| XLogP | 2.82 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|