C14H14ClN5O5S — CID 136787329
N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide (PubChem CID 136787329) has the molecular formula C14H14ClN5O5S and a molecular weight of 399.82 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 136787329 |
| Molecular Formula | C14H14ClN5O5S |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2n[nH]c(=O)[nH]c2=O)cc(Cl)c1O |
| InChI | InChI=1S/C14H14ClN5O5S/c1-2-25-9-4-7(3-8(15)11(9)22)5-16-18-10(21)6-26-13-12(23)17-14(24)20-19-13/h3-5,22H,2,6H2,1H3,(H,18,21)(H2,17,20,23,24)/b16-5+ |
| InChIKey | PKAMWJZBEYJPDW-FZSIALSZSA-N |
| XLogP | 0.46 |
| TPSA | 149.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|