C12H9Cl2N5O3S — CID 6891955
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide (PubChem CID 6891955) has the molecular formula C12H9Cl2N5O3S and a molecular weight of 374.21 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6891955 |
| Molecular Formula | C12H9Cl2N5O3S |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(=O)[nH]c1=O)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N5O3S/c13-7-2-1-6(8(14)3-7)4-15-17-9(20)5-23-11-10(21)16-12(22)19-18-11/h1-4H,5H2,(H,17,20)(H2,16,19,21,22)/b15-4+ |
| InChIKey | QCJYCRIXWMMOAI-SYZQJQIISA-N |
| XLogP | 1.01 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|