C14H15N5O6S — CID 135412058
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 135412058) has the molecular formula C14H15N5O6S and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135412058 |
| Molecular Formula | C14H15N5O6S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)CSc2n[nH]c(=O)[nH]c2=O)cc(OC)c1O |
| InChI | InChI=1S/C14H15N5O6S/c1-24-8-3-7(4-9(25-2)11(8)21)5-15-17-10(20)6-26-13-12(22)16-14(23)19-18-13/h3-5,21H,6H2,1-2H3,(H,17,20)(H2,16,19,22,23)/b15-5+ |
| InChIKey | TZRIWAQPVMSAHH-PJQLUOCWSA-N |
| XLogP | -0.58 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|