C13H12BrN5O4S — CID 110337603
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide (PubChem CID 110337603) has the molecular formula C13H12BrN5O4S and a molecular weight of 414.24 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 110337603 |
| Molecular Formula | C13H12BrN5O4S |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)CSc2n[nH]c(=O)[nH]c2=O)cc1Br |
| InChI | InChI=1S/C13H12BrN5O4S/c1-23-9-3-2-7(4-8(9)14)5-15-17-10(20)6-24-12-11(21)16-13(22)19-18-12/h2-5H,6H2,1H3,(H,17,20)(H2,16,19,21,22)/b15-5+ |
| InChIKey | IVXARNWLTSNDGP-PJQLUOCWSA-N |
| XLogP | 0.47 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|