C13H13N5O3S — CID 110338201
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide (PubChem CID 110338201) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110338201 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccccc1/C=N/NC(=O)CSc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H13N5O3S/c1-8-4-2-3-5-9(8)6-14-16-10(19)7-22-12-11(20)15-13(21)18-17-12/h2-6H,7H2,1H3,(H,16,19)(H2,15,18,20,21)/b14-6+ |
| InChIKey | PZFQTTHTRLXAFZ-MKMNVTDBSA-N |
| XLogP | 0.01 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|