C13H13N5O5S — CID 136911152
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 136911152) has the molecular formula C13H13N5O5S and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136911152 |
| Molecular Formula | C13H13N5O5S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSc2n[nH]c(=O)[nH]c2=O)ccc1O |
| InChI | InChI=1S/C13H13N5O5S/c1-23-9-4-7(2-3-8(9)19)5-14-16-10(20)6-24-12-11(21)15-13(22)18-17-12/h2-5,19H,6H2,1H3,(H,16,20)(H2,15,18,21,22)/b14-5- |
| InChIKey | UBAFFHBVUNCVKH-RZNTYIFUSA-N |
| XLogP | -0.59 |
| TPSA | 149.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|