C18H23N5O5S — CID 110338129
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 110338129) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110338129 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCOc1ccc(/C=N/NC(=O)CSc2n[nH]c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C18H23N5O5S/c1-3-4-5-8-28-13-7-6-12(9-14(13)27-2)10-19-21-15(24)11-29-17-16(25)20-18(26)23-22-17/h6-7,9-10H,3-5,8,11H2,1-2H3,(H,21,24)(H2,20,23,25,26)/b19-10+ |
| InChIKey | IEZMFCBKKLIXBL-VXLYETTFSA-N |
| XLogP | 1.28 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|