C11H11N5O4 — CID 2841509
6-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 2841509) has the molecular formula C11H11N5O4 and a molecular weight of 277.24 g/mol. Its IUPAC name is 6-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 2841509 |
| Molecular Formula | C11H11N5O4 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 6-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | COc1cc(C=NNc2n[nH]c(=O)[nH]c2=O)ccc1O |
| InChI | InChI=1S/C11H11N5O4/c1-20-8-4-6(2-3-7(8)17)5-12-14-9-10(18)13-11(19)16-15-9/h2-5,17H,1H3,(H,14,15)(H2,13,16,18,19) |
| InChIKey | PTYBYHLRWFOBKG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|