C10H8BrN5O2 — CID 4282332
6-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 4282332) has the molecular formula C10H8BrN5O2 and a molecular weight of 310.11 g/mol. Its IUPAC name is 6-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 4282332 |
| Molecular Formula | C10H8BrN5O2 |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 6-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NN=Cc2ccc(Br)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H8BrN5O2/c11-7-3-1-6(2-4-7)5-12-14-8-9(17)13-10(18)16-15-8/h1-5H,(H,14,15)(H2,13,16,17,18) |
| InChIKey | KDRJKQLOBQTZQH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|