C11H9F2N5O3 — CID 4113380
6-[2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 4113380) has the molecular formula C11H9F2N5O3 and a molecular weight of 297.22 g/mol. Its IUPAC name is 6-[2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 4113380 |
| Molecular Formula | C11H9F2N5O3 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 6-[2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NN=Cc2ccccc2OC(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C11H9F2N5O3/c12-10(13)21-7-4-2-1-3-6(7)5-14-16-8-9(19)15-11(20)18-17-8/h1-5,10H,(H,16,17)(H2,15,18,19,20) |
| InChIKey | XMIVORAIJIEECY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|