C17H18N6O3 — CID 4320107
6-[2-[[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 4320107) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 6-[2-[[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-[[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 4320107 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 6-[2-[[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | COc1ccccc1-n1c(C)cc(C=NNc2n[nH]c(=O)[nH]c2=O)c1C |
| InChI | InChI=1S/C17H18N6O3/c1-10-8-12(9-18-20-15-16(24)19-17(25)22-21-15)11(2)23(10)13-6-4-5-7-14(13)26-3/h4-9H,1-3H3,(H,20,21)(H2,19,22,24,25) |
| InChIKey | WFFGXWYDJGJHKH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|