C14H11N5O3 — CID 135504466
6-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 135504466) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 6-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 135504466 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 6-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(N/N=C/c2c(O)ccc3ccccc23)c(=O)[nH]1 |
| InChI | InChI=1S/C14H11N5O3/c20-11-6-5-8-3-1-2-4-9(8)10(11)7-15-17-12-13(21)16-14(22)19-18-12/h1-7,20H,(H,17,18)(H2,16,19,21,22)/b15-7+ |
| InChIKey | GIHFBJIMYQAIKK-VIZOYTHASA-N |
| XLogP | 0.76 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|