C17H11ClF3N3O — CID 135614773
1-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 135614773) has the molecular formula C17H11ClF3N3O and a molecular weight of 365.74 g/mol. Its IUPAC name is 1-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135614773 |
| Molecular Formula | C17H11ClF3N3O |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 1-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N/Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H11ClF3N3O/c18-14-7-11(17(19,20)21)8-22-16(14)24-23-9-13-12-4-2-1-3-10(12)5-6-15(13)25/h1-9,25H,(H,22,24)/b23-9+ |
| InChIKey | POPKAEJVROSADQ-NUGSKGIGSA-N |
| XLogP | 5.06 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|