C10H5Cl3F3N3O2 — CID 6505731
(Z,4Z)-2,3-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]but-2-enoic acid (PubChem CID 6505731) has the molecular formula C10H5Cl3F3N3O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is (Z,4Z)-2,3-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]but-2-enoic acid.
| Compound Name | (Z,4Z)-2,3-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]but-2-enoic acid |
|---|---|
| PubChem CID | 6505731 |
| Molecular Formula | C10H5Cl3F3N3O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | (Z,4Z)-2,3-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]but-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(Cl)\C=N/Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H5Cl3F3N3O2/c11-5-1-4(10(14,15)16)2-17-8(5)19-18-3-6(12)7(13)9(20)21/h1-3H,(H,17,19)(H,20,21)/b7-6-,18-3- |
| InChIKey | PEBHUEXAFKFJHK-PGJIAXESSA-N |
| XLogP | 3.93 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|