C7H5ClF3N3O — CID 70973027
N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]formamide (PubChem CID 70973027) has the molecular formula C7H5ClF3N3O and a molecular weight of 239.58 g/mol. Its IUPAC name is N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]formamide.
| Compound Name | N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]formamide |
|---|---|
| PubChem CID | 70973027 |
| Molecular Formula | C7H5ClF3N3O |
| Molecular Weight | 239.58 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]formamide |
| SMILES | O=CNNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C7H5ClF3N3O/c8-5-1-4(7(9,10)11)2-12-6(5)14-13-3-15/h1-3H,(H,12,14)(H,13,15) |
| InChIKey | SSCMOPHWBPKFFO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|