C12H8ClF3N4O2 — CID 141438327
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2-nitrophenyl)hydrazine (PubChem CID 141438327) has the molecular formula C12H8ClF3N4O2 and a molecular weight of 332.67 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2-nitrophenyl)hydrazine.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2-nitrophenyl)hydrazine |
|---|---|
| PubChem CID | 141438327 |
| Molecular Formula | C12H8ClF3N4O2 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2-nitrophenyl)hydrazine |
| SMILES | O=[N+]([O-])c1ccccc1NNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H8ClF3N4O2/c13-8-5-7(12(14,15)16)6-17-11(8)19-18-9-3-1-2-4-10(9)20(21)22/h1-6,18H,(H,17,19) |
| InChIKey | BGJSQKRUHYLVPX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|